| MolName | 2-[(2-fluorobenzoyl)amino]-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzamide |
| MolecularFormula | C25H17N4O5F |
| Smiles | [O-][N+](c(cc1)ccc1-c1ccc(/C=N\NC(c(cccc2)c2NC(c(cccc2)c2F)=O)=O)o1)=O |
| InChI | InChI=1S/C25H17FN4O5/c26-21-7-3-1-5-19(21)24(31)28-22-8-4-2-6-20(22)25(32)29-27-15-18-13-14-23(35-18)16-9-11-17(12-10-16)30(33)34/h1-15H,(H,28,31)(H,29,32) |
| InChIK | KYRYFSOKWQJPOA-UHFFFAOYSA-N |
| TotalMolweight | 472.431 |
| Molweight | 472.431 |
| MonoisotopicMass | 472.118299 |
| CLogP | 4.4672 |
| CLogS | -7.467 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 355.43 |
| Relative PSA | 0.29553 |
| PolarSurfaceArea | 129.52 |
| Druglikeness | 0.45711 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(2-fluorobenzoyl)amino]-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzamide | 2 - 2-[(2-fluorobenzoyl)amino]-N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzamide