| MolName | 3-fluoro-N-[(Z)-[5-(4-iodophenyl)furan-2-yl]methylideneamino]benzamide |
| MolecularFormula | C18H12N2O2FI |
| Smiles | O=C(c1cc(F)ccc1)N/N=C\c1ccc(-c(cc2)ccc2I)o1 |
| InChI | InChI=1S/C18H12FIN2O2/c19-14-3-1-2-13(10-14)18(23)22-21-11-16-8-9-17(24-16)12-4-6-15(20)7-5-12/h1-11H,(H,22,23) |
| InChIK | KZQJJLYOWOCQBX-UHFFFAOYSA-N |
| TotalMolweight | 434.203 |
| Molweight | 434.203 |
| MonoisotopicMass | 433.992754 |
| CLogP | 4.6784 |
| CLogS | -6.511 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 269.07 |
| Relative PSA | 0.18627 |
| PolarSurfaceArea | 54.6 |
| Druglikeness | 5.5105 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-fluoro-N-[(Z)-[5-(4-iodophenyl)furan-2-yl]methylideneamino]benzamide | 2 - 3-fluoro-N-[(Z)-[5-(4-iodophenyl)furan-2-yl]methylideneamino]benzamide