| MolName | 4-(4-benzylpiperazin-1-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
| MolecularFormula | C23H23N8O3F3 |
| Smiles | [O-][N+](c1ccc(/C=N\Nc2nc(OCC(F)(F)F)nc(N3CCN(Cc4ccccc4)CC3)n2)cc1)=O |
| InChI | InChI=1S/C23H23F3N8O3/c24-23(25,26)16-37-22-29-20(31-27-14-17-6-8-19(9-7-17)34(35)36)28-21(30-22)33-12-10-32(11-13-33)15-18-4-2-1-3-5-18/h1-9,14H,10-13,15-16H2,(H,28,29,30,31) |
| InChIK | KZXGBYYCIBRQMD-UHFFFAOYSA-N |
| TotalMolweight | 516.483 |
| Molweight | 516.483 |
| MonoisotopicMass | 516.184521 |
| CLogP | 4.4315 |
| CLogS | -5.781 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 378.07 |
| Relative PSA | 0.27349 |
| PolarSurfaceArea | 124.59 |
| Druglikeness | -5.0201 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.56757 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 10 |
| Symmetricatoms | 8 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(4-benzylpiperazin-1-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine | 2 - 4-(4-benzylpiperazin-1-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine