| MolName | 3-(4-chlorophenyl)-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1H-pyrazole-5-carboxamide |
| MolecularFormula | C19H14N5O3Cl |
| Smiles | [O-][N+](c1c(/C=C/C=N\NC(c2cc(-c(cc3)ccc3Cl)n[nH]2)=O)cccc1)=O |
| InChI | InChI=1S/C19H14ClN5O3/c20-15-9-7-13(8-10-15)16-12-17(23-22-16)19(26)24-21-11-3-5-14-4-1-2-6-18(14)25(27)28/h1-12H,(H,22,23)(H,24,26) |
| InChIK | KZZLXKQQESCWTQ-UHFFFAOYSA-N |
| TotalMolweight | 395.805 |
| Molweight | 395.805 |
| MonoisotopicMass | 395.078517 |
| CLogP | 2.6021 |
| CLogS | -5.584 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 300.67 |
| Relative PSA | 0.30395 |
| PolarSurfaceArea | 115.96 |
| Druglikeness | 0.56046 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(4-chlorophenyl)-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1H-pyrazole-5-carboxamide | 2 - 3-(4-chlorophenyl)-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1H-pyrazole-5-carboxamide