| MolName | [1-[(Z)-[(4-nitrobenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
| MolecularFormula | C25H15N3O5Cl2 |
| Smiles | [O-][N+](c(cc1)ccc1C(N/N=C\c(c1ccccc1cc1)c1OC(c(ccc(Cl)c1)c1Cl)=O)=O)=O |
| InChI | InChI=1S/C25H15Cl2N3O5/c26-17-8-11-20(22(27)13-17)25(32)35-23-12-7-15-3-1-2-4-19(15)21(23)14-28-29-24(31)16-5-9-18(10-6-16)30(33)34/h1-14H,(H,29,31) |
| InChIK | KZZUVJWUYWMGCM-UHFFFAOYSA-N |
| TotalMolweight | 508.316 |
| Molweight | 508.316 |
| MonoisotopicMass | 507.038876 |
| CLogP | 6.1169 |
| CLogS | -8.729 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 363.61 |
| Relative PSA | 0.24606 |
| PolarSurfaceArea | 113.58 |
| Druglikeness | -1.0349 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-[(4-nitrobenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate | 2 - [1-[(Z)-[(4-nitrobenzoyl)hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate