| MolName | N-[(Z)-[4-[2-[2-[2-[4-[(Z)-(pyridin-2-ylhydrazinylidene)methyl]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]methylideneamino]pyridin-2-amine |
| MolecularFormula | C30H32N6O4 |
| Smiles | C(COCCOc1ccc(/C=N\Nc2ncccc2)cc1)OCCOc1ccc(/C=N\Nc2ncccc2)cc1 |
| InChI | InChI=1S/C30H32N6O4/c1-3-15-31-29(5-1)35-33-23-25-7-11-27(12-8-25)39-21-19-37-17-18-38-20-22-40-28-13-9-26(10-14-28)24-34-36-30-6-2-4-16-32-30/h1-16,23-24H,17-22H2,(H,31,35)(H,32,36) |
| InChIK | LAHKNJTZOLJMHA-UHFFFAOYSA-N |
| TotalMolweight | 540.622 |
| Molweight | 540.622 |
| MonoisotopicMass | 540.248504 |
| CLogP | 7.8932 |
| CLogS | -5.252 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 445.06 |
| Relative PSA | 0.24239 |
| PolarSurfaceArea | 111.48 |
| Druglikeness | -9.6012 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.8 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 17 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 10 |
| Symmetricatoms | 22 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[2-[2-[2-[4-[(Z)-(pyridin-2-ylhydrazinylidene)methyl]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]methylideneamino]pyridin-2-amine | 2 - N-[(Z)-[4-[2-[2-[2-[4-[(Z)-(pyridin-2-ylhydrazinylidene)methyl]phenoxy]ethoxy]ethoxy]ethoxy]phenyl]methylideneamino]pyridin-2-amine