| MolName | [4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| MolecularFormula | C25H25N7O4Cl2 |
| Smiles | O=C(c(ccc(Cl)c1)c1Cl)Oc1ccc(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C25H25Cl2N7O4/c26-18-3-6-20(21(27)15-18)22(35)38-19-4-1-17(2-5-19)16-28-32-23-29-24(33-7-11-36-12-8-33)31-25(30-23)34-9-13-37-14-10-34/h1-6,15-16H,7-14H2,(H,29,30,31,32) |
| InChIK | LAOGXWBFNHQKTR-UHFFFAOYSA-N |
| TotalMolweight | 558.425 |
| Molweight | 558.425 |
| MonoisotopicMass | 557.134507 |
| CLogP | 6.243 |
| CLogS | -6.483 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 407.55 |
| Relative PSA | 0.26014 |
| PolarSurfaceArea | 114.3 |
| Druglikeness | 3.0759 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55263 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 11 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate | 2 - [4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate