| MolName | N-[(Z)-2H-chromen-3-ylmethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| MolecularFormula | C20H18N4OS |
| Smiles | C(CC1)Cc2c1sc1ncnc(N/N=C\C3=Cc(cccc4)c4OC3)c12 |
| InChI | InChI=1S/C20H18N4OS/c1-3-7-16-14(5-1)9-13(11-25-16)10-23-24-19-18-15-6-2-4-8-17(15)26-20(18)22-12-21-19/h1,3,5,7,9-10,12H,2,4,6,8,11H2,(H,21,22,24) |
| InChIK | LAROIDPIXGMTDA-UHFFFAOYSA-N |
| TotalMolweight | 362.456 |
| Molweight | 362.456 |
| MonoisotopicMass | 362.120131 |
| CLogP | 5.6754 |
| CLogS | -6.118 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 273.81 |
| Relative PSA | 0.2749 |
| PolarSurfaceArea | 87.64 |
| Druglikeness | -1.6431 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 6 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-2H-chromen-3-ylmethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine | 2 - N-[(Z)-2H-chromen-3-ylmethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine