| MolName | (2Z)-N-phenyl-2-(2-phenyl-1,5-dioxaspiro[5.5]undec-2-en-4-ylidene)ethanimine |
| MolecularFormula | C23H23NO2 |
| Smiles | C(CC1)CCC1(O1)OC(c2ccccc2)=C/C1=C/C=N/c1ccccc1 |
| InChI | InChI=1S/C23H23NO2/c1-4-10-19(11-5-1)22-18-21(14-17-24-20-12-6-2-7-13-20)25-23(26-22)15-8-3-9-16-23/h1-2,4-7,10-14,17-18H,3,8-9,15-16H2 |
| InChIK | LAUWUUUPNSQKBZ-UHFFFAOYSA-N |
| TotalMolweight | 345.441 |
| Molweight | 345.441 |
| MonoisotopicMass | 345.172879 |
| CLogP | 4.4127 |
| CLogS | -5.092 |
| H Acceptors | 3 |
| TotalSurfaceArea | 279.41 |
| Relative PSA | 0.11277 |
| PolarSurfaceArea | 30.82 |
| Druglikeness | -4.3861 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - (2Z)-N-phenyl-2-(2-phenyl-1,5-dioxaspiro[5.5]undec-2-en-4-ylidene)ethanimine | 2 - (2Z)-N-phenyl-2-(2-phenyl-1,5-dioxaspiro[5.5]undec-2-en-4-ylidene)ethanimine