| MolName | N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-N'-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]oxamide |
| MolecularFormula | C33H24N4O4ClF |
| Smiles | O=C(C(N/N=C\c(c1ccccc1cc1)c1OCc(cc1)ccc1F)=O)Nc(cccc1)c1C(Nc(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C33H24ClFN4O4/c34-23-12-16-25(17-13-23)37-31(40)27-7-3-4-8-29(27)38-32(41)33(42)39-36-19-28-26-6-2-1-5-22(26)11-18-30(28)43-20-21-9-14-24(35)15-10-21/h1-19H,20H2,(H,37,40)(H,38,41)(H,39,42) |
| InChIK | LBGUYVDWWJYNAL-UHFFFAOYSA-N |
| TotalMolweight | 595.029 |
| Molweight | 595.029 |
| MonoisotopicMass | 594.147011 |
| CLogP | 6.5407 |
| CLogS | -9.034 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 445.06 |
| Relative PSA | 0.21348 |
| PolarSurfaceArea | 108.89 |
| Druglikeness | 2.0749 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.55814 |
| Fragments | 1 |
| Non HAtoms | 43 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-N'-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]oxamide | 2 - N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-N'-[(Z)-[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]oxamide