| MolName | 2-N-[(Z)-(2,4-dichloro-5-nitrophenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C20H17N8O3Cl2F |
| Smiles | [O-][N+](c(cc(/C=N\Nc1nc(N2CCOCC2)nc(Nc(cc2)ccc2F)n1)c(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C20H17Cl2FN8O3/c21-15-10-16(22)17(31(32)33)9-12(15)11-24-29-19-26-18(25-14-3-1-13(23)2-4-14)27-20(28-19)30-5-7-34-8-6-30/h1-4,9-11H,5-8H2,(H2,25,26,27,28,29) |
| InChIK | LBKBKIYJPDOGPJ-UHFFFAOYSA-N |
| TotalMolweight | 507.312 |
| Molweight | 507.312 |
| MonoisotopicMass | 506.078469 |
| CLogP | 5.3419 |
| CLogS | -7.262 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 359.44 |
| Relative PSA | 0.30968 |
| PolarSurfaceArea | 133.38 |
| Druglikeness | -3.0445 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-(2,4-dichloro-5-nitrophenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-(2,4-dichloro-5-nitrophenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine