| MolName | 4-[(Z)-[(Z)-3-phenylprop-2-enylidene]amino]-1,2,4-triazolidine-3,5-dione |
| MolecularFormula | C11H10N4O2 |
| Smiles | O=C(NNC1=O)N1/N=C\C=C/c1ccccc1 |
| InChI | InChI=1S/C11H10N4O2/c16-10-13-14-11(17)15(10)12-8-4-7-9-5-2-1-3-6-9/h1-8H,(H,13,16)(H,14,17) |
| InChIK | LBXIVXGRTISQAB-UHFFFAOYSA-N |
| TotalMolweight | 230.226 |
| Molweight | 230.226 |
| MonoisotopicMass | 230.080376 |
| CLogP | 0.0936 |
| CLogS | -3.576 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 179.74 |
| Relative PSA | 0.3564 |
| PolarSurfaceArea | 73.8 |
| Druglikeness | 3.9602 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Symmetricatoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[(Z)-3-phenylprop-2-enylidene]amino]-1,2,4-triazolidine-3,5-dione | 2 - 4-[(Z)-[(Z)-3-phenylprop-2-enylidene]amino]-1,2,4-triazolidine-3,5-dione