| MolName | (Z)-1-(4-bromophenyl)-N-[(Z)-(4-bromophenyl)methylideneamino]methanimine |
| MolecularFormula | C14H10N2Br2 |
| Smiles | Brc1ccc(/C=N\N=C/c(cc2)ccc2Br)cc1 |
| InChI | InChI=1S/C14H10Br2N2/c15-13-5-1-11(2-6-13)9-17-18-10-12-3-7-14(16)8-4-12/h1-10H |
| InChIK | LBYGBPAMWPZZRE-UHFFFAOYSA-N |
| TotalMolweight | 366.055 |
| Molweight | 366.055 |
| MonoisotopicMass | 363.92107 |
| CLogP | 6.236 |
| CLogS | -5.8 |
| H Acceptors | 2 |
| TotalSurfaceArea | 219.8 |
| Relative PSA | 0.10473 |
| PolarSurfaceArea | 24.72 |
| Druglikeness | 0.0071634 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.77778 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 11 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(4-bromophenyl)-N-[(Z)-(4-bromophenyl)methylideneamino]methanimine | 2 - (Z)-1-(4-bromophenyl)-N-[(Z)-(4-bromophenyl)methylideneamino]methanimine