| MolName | N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]benzamide |
| MolecularFormula | C26H19N3O4F2S |
| Smiles | O=C(c1ccc(CN(c2c(c3ccc4)c4ccc2)S3(=O)=O)cc1)N/N=C\c(cccc1)c1OC(F)F |
| InChI | InChI=1S/C26H19F2N3O4S/c27-26(28)35-22-9-2-1-5-20(22)15-29-30-25(32)19-13-11-17(12-14-19)16-31-21-8-3-6-18-7-4-10-23(24(18)21)36(31,33)34/h1-15,26H,16H2,(H,30,32) |
| InChIK | LCFLJSCLNOCRMD-UHFFFAOYSA-N |
| TotalMolweight | 507.516 |
| Molweight | 507.516 |
| MonoisotopicMass | 507.106433 |
| CLogP | 4.966 |
| CLogS | -7.629 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 355.69 |
| Relative PSA | 0.21969 |
| PolarSurfaceArea | 96.45 |
| Druglikeness | -1.5747 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]benzamide | 2 - N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]-4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]benzamide