| MolName | 5-(phenylcarbamoylamino)-N-[(E)-[4-[(Z)-[[5-(phenylcarbamoylamino)thiadiazole-4-carbonyl]hydrazinylidene]methyl]phenyl]methylideneamino]thiadiazole-4-carboxamide |
| MolecularFormula | C28H22N12O4S2 |
| Smiles | O=C(c1c(NC(Nc2ccccc2)=O)snn1)N/N=C/c1ccc(/C=N\NC(c2c(NC(Nc3ccccc3)=O)snn2)=O)cc1 |
| InChI | InChI=1S/C28H22N12O4S2/c41-23(21-25(45-39-35-21)33-27(43)31-19-7-3-1-4-8-19)37-29-15-17-11-13-18(14-12-17)16-30-38-24(42)22-26(46-40-36-22)34-28(44)32-20-9-5-2-6-10-20/h1-16H,(H,37,41)(H,38,42)(H2,31,33,43)(H2,32,34,44) |
| InChIK | LCPPQVCGUKPMBS-UHFFFAOYSA-N |
| TotalMolweight | 654.695 |
| Molweight | 654.695 |
| MonoisotopicMass | 654.132838 |
| CLogP | 5.3752 |
| CLogS | -9.504 |
| H Acceptors | 16 |
| H Donors | 6 |
| TotalSurfaceArea | 488.5 |
| Relative PSA | 0.46784 |
| PolarSurfaceArea | 273.22 |
| Druglikeness | 1.3633 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 46 |
| NonCHAtoms | 18 |
| Electronegative Atoms | 18 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Symmetricatoms | 6 |
| Amides | 4 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - 5-(phenylcarbamoylamino)-N-[(E)-[4-[(Z)-[[5-(phenylcarbamoylamino)thiadiazole-4-carbonyl]hydrazinylidene]methyl]phenyl]methylideneamino]thiadiazole-4-carboxamide | 2 - 5-(phenylcarbamoylamino)-N-[(E)-[4-[(Z)-[[5-(phenylcarbamoylamino)thiadiazole-4-carbonyl]hydrazinylidene]methyl]phenyl]methylideneamino]thiadiazole-4-carboxamide