| MolName | (E)-3-(2-chlorophenyl)-N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine |
| MolecularFormula | C22H14N2OClF |
| Smiles | Fc(cc1)ccc1-c1nc(cc(cc2)/N=C/C=C/c(cccc3)c3Cl)c2o1 |
| InChI | InChI=1S/C22H14ClFN2O/c23-19-6-2-1-4-15(19)5-3-13-25-18-11-12-21-20(14-18)26-22(27-21)16-7-9-17(24)10-8-16/h1-14H |
| InChIK | LDEUBDDTMSWEEM-UHFFFAOYSA-N |
| TotalMolweight | 376.817 |
| Molweight | 376.817 |
| MonoisotopicMass | 376.077868 |
| CLogP | 5.4133 |
| CLogS | -7.49 |
| H Acceptors | 3 |
| TotalSurfaceArea | 288.86 |
| Relative PSA | 0.12667 |
| PolarSurfaceArea | 38.39 |
| Druglikeness | -1.24 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (E)-3-(2-chlorophenyl)-N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine | 2 - (E)-3-(2-chlorophenyl)-N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine