| MolName | [1-[(Z)-[[2-[(3-bromobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
| MolecularFormula | C27H18N3O4BrCl2 |
| Smiles | O=C(CNC(c1cccc(Br)c1)=O)N/N=C\c(c1ccccc1cc1)c1OC(c(ccc(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C27H18BrCl2N3O4/c28-18-6-3-5-17(12-18)26(35)31-15-25(34)33-32-14-22-20-7-2-1-4-16(20)8-11-24(22)37-27(36)21-10-9-19(29)13-23(21)30/h1-14H,15H2,(H,31,35)(H,33,34) |
| InChIK | LDIMFNUNXOBSCN-UHFFFAOYSA-N |
| TotalMolweight | 599.267 |
| Molweight | 599.267 |
| MonoisotopicMass | 596.985772 |
| CLogP | 6.8474 |
| CLogS | -8.87 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 401.54 |
| Relative PSA | 0.20807 |
| PolarSurfaceArea | 96.86 |
| Druglikeness | 3.3116 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54054 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-[[2-[(3-bromobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate | 2 - [1-[(Z)-[[2-[(3-bromobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate