| MolName | 4-[5-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| MolecularFormula | C23H25N7O5 |
| Smiles | OC(c(cc1)ccc1-c1ccc(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)o1)=O |
| InChI | InChI=1S/C23H25N7O5/c31-20(32)17-3-1-16(2-4-17)19-6-5-18(35-19)15-24-28-21-25-22(29-7-11-33-12-8-29)27-23(26-21)30-9-13-34-14-10-30/h1-6,15H,7-14H2,(H,31,32)(H,25,26,27,28) |
| InChIK | LDNIGDOXZPUHPI-UHFFFAOYSA-N |
| TotalMolweight | 479.496 |
| Molweight | 479.496 |
| MonoisotopicMass | 479.191718 |
| CLogP | 3.5133 |
| CLogS | -5.014 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 362.75 |
| Relative PSA | 0.33971 |
| PolarSurfaceArea | 138.44 |
| Druglikeness | 5.0617 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 11 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[5-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]furan-2-yl]benzoic acid | 2 - 4-[5-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]furan-2-yl]benzoic acid