| MolName | N-[(Z)-anthracen-9-ylmethylideneamino]-2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| MolecularFormula | C31H21N5OCl2S |
| Smiles | O=C(CSc1nnc(-c(cc2)ccc2Cl)n1-c(cc1)ccc1Cl)N/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C31H21Cl2N5OS/c32-23-11-9-20(10-12-23)30-36-37-31(38(30)25-15-13-24(33)14-16-25)40-19-29(39)35-34-18-28-26-7-3-1-5-21(26)17-22-6-2-4-8-27(22)28/h1-18H,19H2,(H,35,39) |
| InChIK | LDORRZCJPQHNBH-UHFFFAOYSA-N |
| TotalMolweight | 582.514 |
| Molweight | 582.514 |
| MonoisotopicMass | 581.084384 |
| CLogP | 8.1326 |
| CLogS | -13.1 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 424.52 |
| Relative PSA | 0.19389 |
| PolarSurfaceArea | 97.47 |
| Druglikeness | 5.4489 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.475 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 31 |
| Sp3Atoms | 2 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-anthracen-9-ylmethylideneamino]-2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide | 2 - N-[(Z)-anthracen-9-ylmethylideneamino]-2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide