| MolName | (Z)-1-(2,4-dichlorophenyl)-N-[4-[(Z)-(2,4-dichlorophenyl)methylideneamino]piperazin-1-yl]methanimine |
| MolecularFormula | C18H16N4Cl4 |
| Smiles | Clc1cc(Cl)c(/C=N\N(CC2)CCN2/N=C\c(ccc(Cl)c2)c2Cl)cc1 |
| InChI | InChI=1S/C18H16Cl4N4/c19-15-3-1-13(17(21)9-15)11-23-25-5-7-26(8-6-25)24-12-14-2-4-16(20)10-18(14)22/h1-4,9-12H,5-8H2 |
| InChIK | LDSOWJJTHNMJLW-UHFFFAOYSA-N |
| TotalMolweight | 430.165 |
| Molweight | 430.165 |
| MonoisotopicMass | 428.012904 |
| CLogP | 5.683 |
| CLogS | -6.234 |
| H Acceptors | 4 |
| TotalSurfaceArea | 306.36 |
| Relative PSA | 0.098316 |
| PolarSurfaceArea | 31.2 |
| Druglikeness | 5.4627 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 14 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(2,4-dichlorophenyl)-N-[4-[(Z)-(2,4-dichlorophenyl)methylideneamino]piperazin-1-yl]methanimine | 2 - (Z)-1-(2,4-dichlorophenyl)-N-[4-[(Z)-(2,4-dichlorophenyl)methylideneamino]piperazin-1-yl]methanimine