| MolName | 2-[[(Z)-(5-bromofuran-2-yl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol |
| MolecularFormula | C14H12N3O4BrS |
| Smiles | OCCN(C(c1c2cccc1)=NS2(=O)=O)/N=C\c(o1)ccc1Br |
| InChI | InChI=1S/C14H12BrN3O4S/c15-13-6-5-10(22-13)9-16-18(7-8-19)14-11-3-1-2-4-12(11)23(20,21)17-14/h1-6,9,19H,7-8H2 |
| InChIK | LDYXMTVFRZHNBT-UHFFFAOYSA-N |
| TotalMolweight | 398.236 |
| Molweight | 398.236 |
| MonoisotopicMass | 396.973188 |
| CLogP | 2.3674 |
| CLogS | -3.294 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 248.32 |
| Relative PSA | 0.33167 |
| PolarSurfaceArea | 103.85 |
| Druglikeness | 3.5667 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52174 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| Symmetricatoms | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[(Z)-(5-bromofuran-2-yl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol | 2 - 2-[[(Z)-(5-bromofuran-2-yl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol