| MolName | N-[(Z)-thiophen-3-ylmethylideneamino]-1,3-benzodioxole-5-carboxamide |
| MolecularFormula | C13H10N2O3S |
| Smiles | O=C(c(cc1)cc2c1OCO2)N/N=C\c1cscc1 |
| InChI | InChI=1S/C13H10N2O3S/c16-13(15-14-6-9-3-4-19-7-9)10-1-2-11-12(5-10)18-8-17-11/h1-7H,8H2,(H,15,16) |
| InChIK | LEAYGBWDTRMGPE-UHFFFAOYSA-N |
| TotalMolweight | 274.299 |
| Molweight | 274.299 |
| MonoisotopicMass | 274.041213 |
| CLogP | 3.0974 |
| CLogS | -4.332 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 203.19 |
| Relative PSA | 0.37586 |
| PolarSurfaceArea | 88.16 |
| Druglikeness | 4.7772 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-thiophen-3-ylmethylideneamino]-1,3-benzodioxole-5-carboxamide | 2 - N-[(Z)-thiophen-3-ylmethylideneamino]-1,3-benzodioxole-5-carboxamide