| MolName | 2-(azepan-1-yl)-2-oxo-N-[(Z)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]acetamide |
| MolecularFormula | C26H27N3O3 |
| Smiles | O=C(C(N1CCCCCC1)=O)N/N=C\c(c1ccccc1cc1)c1OCc1ccccc1 |
| InChI | InChI=1S/C26H27N3O3/c30-25(26(31)29-16-8-1-2-9-17-29)28-27-18-23-22-13-7-6-12-21(22)14-15-24(23)32-19-20-10-4-3-5-11-20/h3-7,10-15,18H,1-2,8-9,16-17,19H2,(H,28,30) |
| InChIK | LEFRHADAKJWKFJ-UHFFFAOYSA-N |
| TotalMolweight | 429.518 |
| Molweight | 429.518 |
| MonoisotopicMass | 429.205242 |
| CLogP | 4.7192 |
| CLogS | -5.829 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 342.46 |
| Relative PSA | 0.1828 |
| PolarSurfaceArea | 71 |
| Druglikeness | 0.73308 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 8 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(azepan-1-yl)-2-oxo-N-[(Z)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]acetamide | 2 - 2-(azepan-1-yl)-2-oxo-N-[(Z)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]acetamide