| MolName | 2-hydroxy-N-[(Z)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]acetamide |
| MolecularFormula | C20H18N2O3 |
| Smiles | OCC(N/N=C\c(c1ccccc1cc1)c1OCc1ccccc1)=O |
| InChI | InChI=1S/C20H18N2O3/c23-13-20(24)22-21-12-18-17-9-5-4-8-16(17)10-11-19(18)25-14-15-6-2-1-3-7-15/h1-12,23H,13-14H2,(H,22,24) |
| InChIK | LEWBGNQMMVZTEC-UHFFFAOYSA-N |
| TotalMolweight | 334.374 |
| Molweight | 334.374 |
| MonoisotopicMass | 334.131743 |
| CLogP | 3.3736 |
| CLogS | -4.991 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 265.46 |
| Relative PSA | 0.22267 |
| PolarSurfaceArea | 70.92 |
| Druglikeness | 4.3114 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-N-[(Z)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]acetamide | 2 - 2-hydroxy-N-[(Z)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]acetamide