| MolName | N,N'-bis[(Z)-1,3-benzodioxol-5-ylmethylideneamino]hexanediamide |
| MolecularFormula | C22H22N4O6 |
| Smiles | O=C(CCCCC(N/N=C\c(cc1)cc2c1OCO2)=O)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C22H22N4O6/c27-21(25-23-11-15-5-7-17-19(9-15)31-13-29-17)3-1-2-4-22(28)26-24-12-16-6-8-18-20(10-16)32-14-30-18/h5-12H,1-4,13-14H2,(H,25,27)(H,26,28) |
| InChIK | LEWJDXJCRAJFCX-UHFFFAOYSA-N |
| TotalMolweight | 438.439 |
| Molweight | 438.439 |
| MonoisotopicMass | 438.153936 |
| CLogP | 4.5788 |
| CLogS | -6.62 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 336.52 |
| Relative PSA | 0.33288 |
| PolarSurfaceArea | 119.84 |
| Druglikeness | -4.2769 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 10 |
| Symmetricatoms | 16 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-1,3-benzodioxol-5-ylmethylideneamino]hexanediamide | 2 - N,N'-bis[(Z)-1,3-benzodioxol-5-ylmethylideneamino]hexanediamide