| MolName | 2-(2-bromo-4-nitrophenoxy)-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]acetamide |
| MolecularFormula | C13H9N4O7Br |
| Smiles | [O-][N+](c1ccc(/C=N\NC(COc(ccc([N+]([O-])=O)c2)c2Br)=O)o1)=O |
| InChI | InChI=1S/C13H9BrN4O7/c14-10-5-8(17(20)21)1-3-11(10)24-7-12(19)16-15-6-9-2-4-13(25-9)18(22)23/h1-6H,7H2,(H,16,19) |
| InChIK | LFESRIQRHSTJGL-UHFFFAOYSA-N |
| TotalMolweight | 413.139 |
| Molweight | 413.139 |
| MonoisotopicMass | 411.965462 |
| CLogP | 1.1986 |
| CLogS | -5.462 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 266.41 |
| Relative PSA | 0.45404 |
| PolarSurfaceArea | 155.47 |
| Druglikeness | 1.2197 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-bromo-4-nitrophenoxy)-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]acetamide | 2 - 2-(2-bromo-4-nitrophenoxy)-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]acetamide