| MolName | N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-2-(4-oxo-3H-phthalazin-1-yl)acetamide |
| MolecularFormula | C21H15N5O5 |
| Smiles | [O-][N+](c(cc1)ccc1-c1ccc(/C=N\NC(CC(c2c3cccc2)=NNC3=O)=O)o1)=O |
| InChI | InChI=1S/C21H15N5O5/c27-20(11-18-16-3-1-2-4-17(16)21(28)25-23-18)24-22-12-15-9-10-19(31-15)13-5-7-14(8-6-13)26(29)30/h1-10,12H,11H2,(H,24,27)(H,25,28) |
| InChIK | LFLGVEOVGXEPLR-UHFFFAOYSA-N |
| TotalMolweight | 417.38 |
| Molweight | 417.38 |
| MonoisotopicMass | 417.10732 |
| CLogP | 2.718 |
| CLogS | -6.752 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 312.55 |
| Relative PSA | 0.3729 |
| PolarSurfaceArea | 141.88 |
| Druglikeness | 1.7452 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-2-(4-oxo-3H-phthalazin-1-yl)acetamide | 2 - N-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-2-(4-oxo-3H-phthalazin-1-yl)acetamide