| MolName | N-[(Z)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1H-benzimidazol-2-amine |
| MolecularFormula | C25H18N4OBr2 |
| Smiles | Brc1cc(/C=N\Nc2nc(cccc3)c3[nH]2)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C25H18Br2N4O/c26-20-12-16(14-28-31-25-29-22-10-3-4-11-23(22)30-25)13-21(27)24(20)32-15-18-8-5-7-17-6-1-2-9-19(17)18/h1-14H,15H2,(H2,29,30,31) |
| InChIK | LFMZCEDJUWGYOG-UHFFFAOYSA-N |
| TotalMolweight | 550.253 |
| Molweight | 550.253 |
| MonoisotopicMass | 547.984733 |
| CLogP | 8.8029 |
| CLogS | -8.246 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 347.55 |
| Relative PSA | 0.16668 |
| PolarSurfaceArea | 62.3 |
| Druglikeness | 0.81363 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59375 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 2 |
| Symmetricatoms | 3 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1H-benzimidazol-2-amine | 2 - N-[(Z)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1H-benzimidazol-2-amine