| MolName | N-[(Z)-[4-[(Z)-(thiophene-2-carbonylhydrazinylidene)methyl]phenyl]methylideneamino]thiophene-2-carboxamide |
| MolecularFormula | C18H14N4O2S2 |
| Smiles | O=C(c1cccs1)N/N=C\c1ccc(/C=N\NC(c2cccs2)=O)cc1 |
| InChI | InChI=1S/C18H14N4O2S2/c23-17(15-3-1-9-25-15)21-19-11-13-5-7-14(8-6-13)12-20-22-18(24)16-4-2-10-26-16/h1-12H,(H,21,23)(H,22,24) |
| InChIK | LFNWCJHQLMQYRU-UHFFFAOYSA-N |
| TotalMolweight | 382.467 |
| Molweight | 382.467 |
| MonoisotopicMass | 382.055816 |
| CLogP | 4.4768 |
| CLogS | -5.846 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 292.6 |
| Relative PSA | 0.3853 |
| PolarSurfaceArea | 139.4 |
| Druglikeness | 6.1817 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Symmetricatoms | 14 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[(Z)-(thiophene-2-carbonylhydrazinylidene)methyl]phenyl]methylideneamino]thiophene-2-carboxamide | 2 - N-[(Z)-[4-[(Z)-(thiophene-2-carbonylhydrazinylidene)methyl]phenyl]methylideneamino]thiophene-2-carboxamide