| MolName | 3-[5-[(Z)-[[2-(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| MolecularFormula | C20H14N2O5BrCl |
| Smiles | OC(c1cccc(-c2ccc(/C=N\NC(COc(ccc(Cl)c3)c3Br)=O)o2)c1)=O |
| InChI | InChI=1S/C20H14BrClN2O5/c21-16-9-14(22)4-6-18(16)28-11-19(25)24-23-10-15-5-7-17(29-15)12-2-1-3-13(8-12)20(26)27/h1-10H,11H2,(H,24,25)(H,26,27) |
| InChIK | LFWPVGHNEFIAQP-UHFFFAOYSA-N |
| TotalMolweight | 477.697 |
| Molweight | 477.697 |
| MonoisotopicMass | 475.977461 |
| CLogP | 4.5317 |
| CLogS | -6.544 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 318.35 |
| Relative PSA | 0.27096 |
| PolarSurfaceArea | 101.13 |
| Druglikeness | 4.5309 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[5-[(Z)-[[2-(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid | 2 - 3-[5-[(Z)-[[2-(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid