| MolName | 1-cyclohexyl-3-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea |
| MolecularFormula | C25H27N5O2S |
| Smiles | S=C(NC1CCCCC1)N/N=C\c1cn(-c2ccccc2)nc1-c(cc1)cc2c1OCCO2 |
| InChI | InChI=1S/C25H27N5O2S/c33-25(27-20-7-3-1-4-8-20)28-26-16-19-17-30(21-9-5-2-6-10-21)29-24(19)18-11-12-22-23(15-18)32-14-13-31-22/h2,5-6,9-12,15-17,20H,1,3-4,7-8,13-14H2,(H2,27,28,33) |
| InChIK | LGELJHNNFLIPGW-UHFFFAOYSA-N |
| TotalMolweight | 461.588 |
| Molweight | 461.588 |
| MonoisotopicMass | 461.188545 |
| CLogP | 4.337 |
| CLogS | -6.083 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 362.95 |
| Relative PSA | 0.27626 |
| PolarSurfaceArea | 104.79 |
| Druglikeness | -8.2017 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 11 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-cyclohexyl-3-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea | 2 - 1-cyclohexyl-3-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea