| MolName | 8-chloro-3-[(Z)-(2,4,6-tribromophenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| MolecularFormula | C17H8N4O2Br3Cl |
| Smiles | O=C(c([nH]c(cc1)c2cc1Cl)c2NC1=O)N1/N=C\c(c(Br)cc(Br)c1)c1Br |
| InChI | InChI=1S/C17H8Br3ClN4O2/c18-7-3-11(19)10(12(20)4-7)6-22-25-16(26)15-14(24-17(25)27)9-5-8(21)1-2-13(9)23-15/h1-6,23H,(H,24,27) |
| InChIK | LGPVSVIQUZDDLT-UHFFFAOYSA-N |
| TotalMolweight | 575.442 |
| Molweight | 575.442 |
| MonoisotopicMass | 571.788586 |
| CLogP | 5.298 |
| CLogS | -7.885 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 297.02 |
| Relative PSA | 0.22419 |
| PolarSurfaceArea | 77.56 |
| Druglikeness | 3.527 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 2 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Symmetricatoms | 3 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 8-chloro-3-[(Z)-(2,4,6-tribromophenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione | 2 - 8-chloro-3-[(Z)-(2,4,6-tribromophenyl)methylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione