| MolName | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide |
| MolecularFormula | C18H14N4O3 |
| Smiles | O=C(c1cc(-c2ccccc2)n[nH]1)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C18H14N4O3/c23-18(15-9-14(20-21-15)13-4-2-1-3-5-13)22-19-10-12-6-7-16-17(8-12)25-11-24-16/h1-10H,11H2,(H,20,21)(H,22,23) |
| InChIK | LHDNPUFZTLYZMT-UHFFFAOYSA-N |
| TotalMolweight | 334.334 |
| Molweight | 334.334 |
| MonoisotopicMass | 334.106591 |
| CLogP | 3.0108 |
| CLogS | -4.807 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 255.34 |
| Relative PSA | 0.31711 |
| PolarSurfaceArea | 88.6 |
| Druglikeness | 5.4954 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide | 2 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide