| MolName | 2-(naphthalen-1-ylamino)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C26H23N3O2 |
| Smiles | O=C(CNc1cccc2ccccc12)N/N=C\c(cccc1)c1OCc1ccccc1 |
| InChI | InChI=1S/C26H23N3O2/c30-26(18-27-24-15-8-13-21-11-4-6-14-23(21)24)29-28-17-22-12-5-7-16-25(22)31-19-20-9-2-1-3-10-20/h1-17,27H,18-19H2,(H,29,30) |
| InChIK | LHFCUKPIFIYPKI-UHFFFAOYSA-N |
| TotalMolweight | 409.488 |
| Molweight | 409.488 |
| MonoisotopicMass | 409.179027 |
| CLogP | 5.036 |
| CLogS | -6.49 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 330.33 |
| Relative PSA | 0.17398 |
| PolarSurfaceArea | 62.72 |
| Druglikeness | 4.666 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(naphthalen-1-ylamino)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide | 2 - 2-(naphthalen-1-ylamino)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide