| MolName | N-[(Z)-[5-(2-fluorophenyl)furan-2-yl]methylideneamino]-1H-benzimidazol-2-amine |
| MolecularFormula | C18H13N4OF |
| Smiles | Fc(cccc1)c1-c1ccc(/C=N\Nc2nc(cccc3)c3[nH]2)o1 |
| InChI | InChI=1S/C18H13FN4O/c19-14-6-2-1-5-13(14)17-10-9-12(24-17)11-20-23-18-21-15-7-3-4-8-16(15)22-18/h1-11H,(H2,21,22,23) |
| InChIK | LHFWMINOWZHNGG-UHFFFAOYSA-N |
| TotalMolweight | 320.326 |
| Molweight | 320.326 |
| MonoisotopicMass | 320.107339 |
| CLogP | 5.8497 |
| CLogS | -5.405 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 247.97 |
| Relative PSA | 0.25019 |
| PolarSurfaceArea | 66.21 |
| Druglikeness | 3.7792 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2-fluorophenyl)furan-2-yl]methylideneamino]-1H-benzimidazol-2-amine | 2 - N-[(Z)-[5-(2-fluorophenyl)furan-2-yl]methylideneamino]-1H-benzimidazol-2-amine