| MolName | N-(3-bromophenyl)-N'-[(Z)-(3-bromophenyl)methylideneamino]oxamide |
| MolecularFormula | C15H11N3O2Br2 |
| Smiles | O=C(C(N/N=C\c1cc(Br)ccc1)=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C15H11Br2N3O2/c16-11-4-1-3-10(7-11)9-18-20-15(22)14(21)19-13-6-2-5-12(17)8-13/h1-9H,(H,19,21)(H,20,22) |
| InChIK | LHMPDTQVLAWQSX-UHFFFAOYSA-N |
| TotalMolweight | 425.079 |
| Molweight | 425.079 |
| MonoisotopicMass | 422.921799 |
| CLogP | 3.5943 |
| CLogS | -5.193 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 253.46 |
| Relative PSA | 0.23874 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | 1.9578 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(3-bromophenyl)-N'-[(Z)-(3-bromophenyl)methylideneamino]oxamide | 2 - N-(3-bromophenyl)-N'-[(Z)-(3-bromophenyl)methylideneamino]oxamide