| MolName | 4,11-dibenzyl-5-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| MolecularFormula | C30H26N5OClS |
| Smiles | O=C1N(Cc2ccccc2)C(N/N=C\c(cc2)ccc2Cl)=Nc2c1c(CCN(Cc1ccccc1)C1)c1s2 |
| InChI | InChI=1S/C30H26ClN5OS/c31-24-13-11-21(12-14-24)17-32-34-30-33-28-27(29(37)36(30)19-23-9-5-2-6-10-23)25-15-16-35(20-26(25)38-28)18-22-7-3-1-4-8-22/h1-14,17H,15-16,18-20H2,(H,33,34) |
| InChIK | LIBJBPQBPUHWSU-UHFFFAOYSA-N |
| TotalMolweight | 540.089 |
| Molweight | 540.089 |
| MonoisotopicMass | 539.154657 |
| CLogP | 6.0608 |
| CLogS | -7.357 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 403.24 |
| Relative PSA | 0.18594 |
| PolarSurfaceArea | 88.54 |
| Druglikeness | 8.0776 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52632 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 6 |
| Symmetricatoms | 6 |
| Amides | 1 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4,11-dibenzyl-5-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one | 2 - 4,11-dibenzyl-5-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one