| MolName | (Z)-1-(5-bromothiophen-2-yl)-N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanimine |
| MolecularFormula | C20H20N3BrS |
| Smiles | Brc1ccc(/C=N\N2CCN(Cc3cccc4ccccc34)CC2)s1 |
| InChI | InChI=1S/C20H20BrN3S/c21-20-9-8-18(25-20)14-22-24-12-10-23(11-13-24)15-17-6-3-5-16-4-1-2-7-19(16)17/h1-9,14H,10-13,15H2 |
| InChIK | LIIPHMKRKKTGAN-UHFFFAOYSA-N |
| TotalMolweight | 414.37 |
| Molweight | 414.37 |
| MonoisotopicMass | 413.056128 |
| CLogP | 5.0099 |
| CLogS | -5.123 |
| H Acceptors | 3 |
| TotalSurfaceArea | 282.85 |
| Relative PSA | 0.13778 |
| PolarSurfaceArea | 47.08 |
| Druglikeness | 4.5125 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(5-bromothiophen-2-yl)-N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanimine | 2 - (Z)-1-(5-bromothiophen-2-yl)-N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methanimine