| MolName | 2-[(Z)-3-cyclohexylpropylideneamino]guanidine |
| MolecularFormula | C10H20N4 |
| Smiles | NC(N)=N/N=C\CCC1CCCCC1 |
| InChI | InChI=1S/C10H20N4/c11-10(12)14-13-8-4-7-9-5-2-1-3-6-9/h8-9H,1-7H2,(H4,11,12,14) |
| InChIK | LIMWHBGGZFWBGO-UHFFFAOYSA-N |
| TotalMolweight | 196.297 |
| Molweight | 196.297 |
| MonoisotopicMass | 196.168796 |
| CLogP | 2.3715 |
| CLogS | -3.608 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 173.59 |
| Relative PSA | 0.30854 |
| PolarSurfaceArea | 76.76 |
| Druglikeness | -3.218 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.78571 |
| Fragments | 1 |
| Non HAtoms | 14 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Sp3Atoms | 8 |
| Symmetricatoms | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-3-cyclohexylpropylideneamino]guanidine | 2 - 2-[(Z)-3-cyclohexylpropylideneamino]guanidine