| MolName | 2-fluoro-N-[(Z)-(2-fluorophenyl)methylideneamino]benzamide |
| MolecularFormula | C14H10N2OF2 |
| Smiles | O=C(c(cccc1)c1F)N/N=C\c(cccc1)c1F |
| InChI | InChI=1S/C14H10F2N2O/c15-12-7-3-1-5-10(12)9-17-18-14(19)11-6-2-4-8-13(11)16/h1-9H,(H,18,19) |
| InChIK | LINUADIYGGRRSX-UHFFFAOYSA-N |
| TotalMolweight | 260.242 |
| Molweight | 260.242 |
| MonoisotopicMass | 260.076119 |
| CLogP | 3.4032 |
| CLogS | -4.349 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 199.69 |
| Relative PSA | 0.18033 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 3.1287 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| StereoCon |
Click to Load Molecule:
1 - 2-fluoro-N-[(Z)-(2-fluorophenyl)methylideneamino]benzamide | 2 - 2-fluoro-N-[(Z)-(2-fluorophenyl)methylideneamino]benzamide