| MolName | 2-(9-oxoacridin-10-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
| MolecularFormula | C20H15N3O2S |
| Smiles | O=C(CN(c1c2cccc1)c(cccc1)c1C2=O)N/N=C\c1cccs1 |
| InChI | InChI=1S/C20H15N3O2S/c24-19(22-21-12-14-6-5-11-26-14)13-23-17-9-3-1-7-15(17)20(25)16-8-2-4-10-18(16)23/h1-12H,13H2,(H,22,24) |
| InChIK | LJWICSHRTYNHIA-UHFFFAOYSA-N |
| TotalMolweight | 361.424 |
| Molweight | 361.424 |
| MonoisotopicMass | 361.088497 |
| CLogP | 4.1745 |
| CLogS | -6.563 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 271 |
| Relative PSA | 0.26923 |
| PolarSurfaceArea | 90.01 |
| Druglikeness | 7.6396 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(9-oxoacridin-10-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide | 2 - 2-(9-oxoacridin-10-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide