| MolName | (Z)-1-[1-[2-(4-cyclohexylphenoxy)ethyl]indol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C25H27N5O |
| Smiles | C(COc1ccc(C2CCCCC2)cc1)n1c(cccc2)c2c(/C=N\n2cnnc2)c1 |
| InChI | InChI=1S/C25H27N5O/c1-2-6-20(7-3-1)21-10-12-23(13-11-21)31-15-14-29-17-22(16-28-30-18-26-27-19-30)24-8-4-5-9-25(24)29/h4-5,8-13,16-20H,1-3,6-7,14-15H2 |
| InChIK | LKBNQBKDIMBOFE-UHFFFAOYSA-N |
| TotalMolweight | 413.523 |
| Molweight | 413.523 |
| MonoisotopicMass | 413.22156 |
| CLogP | 4.812 |
| CLogS | -7.22 |
| H Acceptors | 6 |
| TotalSurfaceArea | 333.38 |
| Relative PSA | 0.17155 |
| PolarSurfaceArea | 57.23 |
| Druglikeness | 0.1404 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 9 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[1-[2-(4-cyclohexylphenoxy)ethyl]indol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[1-[2-(4-cyclohexylphenoxy)ethyl]indol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine