| MolName | 3-[(Z)-benzylideneamino]-8-fluoro-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| MolecularFormula | C17H11N4O2F |
| Smiles | O=C(c([nH]c(cc1)c2cc1F)c2NC1=O)N1/N=C\c1ccccc1 |
| InChI | InChI=1S/C17H11FN4O2/c18-11-6-7-13-12(8-11)14-15(20-13)16(23)22(17(24)21-14)19-9-10-4-2-1-3-5-10/h1-9,20H,(H,21,24) |
| InChIK | LKJCDOVFTWJGDU-UHFFFAOYSA-N |
| TotalMolweight | 322.298 |
| Molweight | 322.298 |
| MonoisotopicMass | 322.086604 |
| CLogP | 2.6172 |
| CLogS | -4.961 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 232.06 |
| Relative PSA | 0.28695 |
| PolarSurfaceArea | 77.56 |
| Druglikeness | 3.9427 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 2 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-benzylideneamino]-8-fluoro-1,5-dihydropyrimido[5,4-b]indole-2,4-dione | 2 - 3-[(Z)-benzylideneamino]-8-fluoro-1,5-dihydropyrimido[5,4-b]indole-2,4-dione