| MolName | N-[(Z)-[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| MolecularFormula | C28H20N5FS |
| Smiles | Fc1c(Cn2c(cccc3)c3c(/C=N\Nc3c(c(-c4ccccc4)cs4)c4ncn3)c2)cccc1 |
| InChI | InChI=1S/C28H20FN5S/c29-24-12-6-4-10-20(24)15-34-16-21(22-11-5-7-13-25(22)34)14-32-33-27-26-23(19-8-2-1-3-9-19)17-35-28(26)31-18-30-27/h1-14,16-18H,15H2,(H,30,31,33) |
| InChIK | LKWQKKZMLBAZQB-UHFFFAOYSA-N |
| TotalMolweight | 477.566 |
| Molweight | 477.566 |
| MonoisotopicMass | 477.142343 |
| CLogP | 7.9542 |
| CLogS | -8.014 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 360.73 |
| Relative PSA | 0.19998 |
| PolarSurfaceArea | 83.34 |
| Druglikeness | 3.2182 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51429 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 30 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine | 2 - N-[(Z)-[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine