| MolName | [4-bromo-2-[(Z)-[[2-(4-phenylmethoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| MolecularFormula | C29H23N2O5Br |
| Smiles | O=C(COc(cc1)ccc1OCc1ccccc1)N/N=C\c(cc(cc1)Br)c1OC(c1ccccc1)=O |
| InChI | InChI=1S/C29H23BrN2O5/c30-24-11-16-27(37-29(34)22-9-5-2-6-10-22)23(17-24)18-31-32-28(33)20-36-26-14-12-25(13-15-26)35-19-21-7-3-1-4-8-21/h1-18H,19-20H2,(H,32,33) |
| InChIK | LLAVVRKAKIKTSD-UHFFFAOYSA-N |
| TotalMolweight | 559.415 |
| Molweight | 559.415 |
| MonoisotopicMass | 558.079034 |
| CLogP | 6.2803 |
| CLogS | -7.146 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 400.41 |
| Relative PSA | 0.19742 |
| PolarSurfaceArea | 86.22 |
| Druglikeness | 2.1789 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64865 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 11 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 5 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[[2-(4-phenylmethoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate | 2 - [4-bromo-2-[(Z)-[[2-(4-phenylmethoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate