| MolName | [4-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| MolecularFormula | C27H30N7O2Cl |
| Smiles | O=C(c(cccc1)c1Cl)Oc1ccc(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C27H30ClN7O2/c28-23-10-4-3-9-22(23)24(36)37-21-13-11-20(12-14-21)19-29-33-25-30-26(34-15-5-1-6-16-34)32-27(31-25)35-17-7-2-8-18-35/h3-4,9-14,19H,1-2,5-8,15-18H2,(H,30,31,32,33) |
| InChIK | LLRYXCUAOWAPAQ-UHFFFAOYSA-N |
| TotalMolweight | 520.035 |
| Molweight | 520.035 |
| MonoisotopicMass | 519.21495 |
| CLogP | 7.965 |
| CLogS | -7.525 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 399.65 |
| Relative PSA | 0.21524 |
| PolarSurfaceArea | 95.84 |
| Druglikeness | 2.2204 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54054 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 11 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate | 2 - [4-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate