| MolName | [3-(4-chlorobenzoyl)oxy-4-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| MolecularFormula | C28H18N2O6Cl2 |
| Smiles | Oc(cccc1)c1C(N/N=C\c(ccc(OC(c(cc1)ccc1Cl)=O)c1)c1OC(c(cc1)ccc1Cl)=O)=O |
| InChI | InChI=1S/C28H18Cl2N2O6/c29-20-10-5-17(6-11-20)27(35)37-22-14-9-19(16-31-32-26(34)23-3-1-2-4-24(23)33)25(15-22)38-28(36)18-7-12-21(30)13-8-18/h1-16,33H,(H,32,34) |
| InChIK | LMDNRALOVNPVRM-UHFFFAOYSA-N |
| TotalMolweight | 549.365 |
| Molweight | 549.365 |
| MonoisotopicMass | 548.054192 |
| CLogP | 6.9289 |
| CLogS | -7.837 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 399.2 |
| Relative PSA | 0.23845 |
| PolarSurfaceArea | 114.29 |
| Druglikeness | 4.0444 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [3-(4-chlorobenzoyl)oxy-4-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate | 2 - [3-(4-chlorobenzoyl)oxy-4-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate