| MolName | 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-cyclohexylmethylideneamino]benzamide |
| MolecularFormula | C20H22N3O3ClS |
| Smiles | O=C(c1cccc(S(Nc(cc2)ccc2Cl)(=O)=O)c1)N/N=C\C1CCCCC1 |
| InChI | InChI=1S/C20H22ClN3O3S/c21-17-9-11-18(12-10-17)24-28(26,27)19-8-4-7-16(13-19)20(25)23-22-14-15-5-2-1-3-6-15/h4,7-15,24H,1-3,5-6H2,(H,23,25) |
| InChIK | LMJGEKJVNSNVKK-UHFFFAOYSA-N |
| TotalMolweight | 419.932 |
| Molweight | 419.932 |
| MonoisotopicMass | 419.107039 |
| CLogP | 3.6961 |
| CLogS | -5.868 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 310.25 |
| Relative PSA | 0.24512 |
| PolarSurfaceArea | 96.01 |
| Druglikeness | -3.3069 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-cyclohexylmethylideneamino]benzamide | 2 - 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-cyclohexylmethylideneamino]benzamide