| MolName | [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[4-[(4-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| MolecularFormula | C35H23N2O6Cl3 |
| Smiles | O=C(c(cc1)ccc1OCc(cc1)ccc1Cl)N/N=C\c(ccc(OC(c(cc1)ccc1Cl)=O)c1)c1OC(c(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C35H23Cl3N2O6/c36-27-10-1-22(2-11-27)21-44-30-16-7-23(8-17-30)33(41)40-39-20-26-9-18-31(45-34(42)24-3-12-28(37)13-4-24)19-32(26)46-35(43)25-5-14-29(38)15-6-25/h1-20H,21H2,(H,40,41) |
| InChIK | LMSZJMSXCWPUHN-UHFFFAOYSA-N |
| TotalMolweight | 673.935 |
| Molweight | 673.935 |
| MonoisotopicMass | 672.062169 |
| CLogP | 9.2287 |
| CLogS | -10.21 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 491.79 |
| Relative PSA | 0.18725 |
| PolarSurfaceArea | 103.29 |
| Druglikeness | 3.8381 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56522 |
| Fragments | 1 |
| Non HAtoms | 46 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 12 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 30 |
| Sp3Atoms | 4 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[4-[(4-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate | 2 - [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[4-[(4-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate