| MolName | [2-[(Z)-[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| MolecularFormula | C24H16N5O4ClS |
| Smiles | O=C(C(N/N=C\c(cccc1)c1OC(c(cc1)ccc1Cl)=O)=O)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C24H16ClN5O4S/c25-18-12-10-16(11-13-18)23(33)34-19-9-5-4-8-17(19)14-26-28-21(32)20(31)27-24-30-29-22(35-24)15-6-2-1-3-7-15/h1-14H,(H,28,32)(H,27,30,31) |
| InChIK | LMWNCHYMDONGDZ-UHFFFAOYSA-N |
| TotalMolweight | 505.941 |
| Molweight | 505.941 |
| MonoisotopicMass | 505.061152 |
| CLogP | 4.8484 |
| CLogS | -6.235 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 372.35 |
| Relative PSA | 0.33799 |
| PolarSurfaceArea | 150.88 |
| Druglikeness | 4.8849 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.62857 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate | 2 - [2-[(Z)-[[2-oxo-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate